C15H5BF6 — CID 174395996
2-(2,3,4,6,7,8-hexafluoronaphthalen-1-yl)borinine (PubChem CID 174395996) has the molecular formula C15H5BF6 and a molecular weight of 310.00 g/mol. Its IUPAC name is 2-(2,3,4,6,7,8-hexafluoronaphthalen-1-yl)borinine.
| Compound Name | 2-(2,3,4,6,7,8-hexafluoronaphthalen-1-yl)borinine |
|---|---|
| PubChem CID | 174395996 |
| Molecular Formula | C15H5BF6 |
| Molecular Weight | 310.00 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-(2,3,4,6,7,8-hexafluoronaphthalen-1-yl)borinine |
| SMILES | Fc1cc2c(F)c(F)c(F)c(-c3bcccc3)c2c(F)c1F |
| InChI | InChI=1S/C15H5BF6/c17-8-5-6-9(13(20)12(8)19)10(7-3-1-2-4-16-7)14(21)15(22)11(6)18/h1-5H |
| InChIKey | XKOULFNPHJFGEA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.00 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|