C8H15NO4S2 — CID 174396120
(2S)-2-amino-4-(prop-2-enylsulfonylmethylsulfanyl)butanoic acid (PubChem CID 174396120) has the molecular formula C8H15NO4S2 and a molecular weight of 253.34 g/mol. Its IUPAC name is (2S)-2-amino-4-(prop-2-enylsulfonylmethylsulfanyl)butanoic acid.
| Compound Name | (2S)-2-amino-4-(prop-2-enylsulfonylmethylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 174396120 |
| Molecular Formula | C8H15NO4S2 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | (2S)-2-amino-4-(prop-2-enylsulfonylmethylsulfanyl)butanoic acid |
| SMILES | C=CCS(=O)(=O)CSCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H15NO4S2/c1-2-5-15(12,13)6-14-4-3-7(9)8(10)11/h2,7H,1,3-6,9H2,(H,10,11)/t7-/m0/s1 |
| InChIKey | FGSIXRWUIIWYDT-ZETCQYMHSA-N |
| XLogP | 0.08 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|