C22H35NO3S — CID 174396726
2-(3,5-ditert-butyl-4-hydroxyphenyl)-3-(3-hydroxypropyl)-5-methyl-1,3-thiazolidine-4-carbaldehyde (PubChem CID 174396726) has the molecular formula C22H35NO3S and a molecular weight of 393.59 g/mol. Its IUPAC name is 2-(3,5-ditert-butyl-4-hydroxyphenyl)-3-(3-hydroxypropyl)-5-methyl-1,3-thiazolidine-4-carbaldehyde.
| Compound Name | 2-(3,5-ditert-butyl-4-hydroxyphenyl)-3-(3-hydroxypropyl)-5-methyl-1,3-thiazolidine-4-carbaldehyde |
|---|---|
| PubChem CID | 174396726 |
| Molecular Formula | C22H35NO3S |
| Molecular Weight | 393.59 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 2-(3,5-ditert-butyl-4-hydroxyphenyl)-3-(3-hydroxypropyl)-5-methyl-1,3-thiazolidine-4-carbaldehyde |
| SMILES | CC1SC(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)N(CCCO)C1C=O |
| InChI | InChI=1S/C22H35NO3S/c1-14-18(13-25)23(9-8-10-24)20(27-14)15-11-16(21(2,3)4)19(26)17(12-15)22(5,6)7/h11-14,18,20,24,26H,8-10H2,1-7H3 |
| InChIKey | HIPDHZAFJUQYNB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|