C25H38BrNO4S — CID 174369039
ethyl 3-(3-bromopropyl)-2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-formyl-2-methyl-1,3-thiazolidine-5-carboxylate (PubChem CID 174369039) has the molecular formula C25H38BrNO4S and a molecular weight of 528.55 g/mol. Its IUPAC name is ethyl 3-(3-bromopropyl)-2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-formyl-2-methyl-1,3-thiazolidine-5-carboxylate.
| Compound Name | ethyl 3-(3-bromopropyl)-2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-formyl-2-methyl-1,3-thiazolidine-5-carboxylate |
|---|---|
| PubChem CID | 174369039 |
| Molecular Formula | C25H38BrNO4S |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | ethyl 3-(3-bromopropyl)-2-(3,5-ditert-butyl-4-hydroxyphenyl)-4-formyl-2-methyl-1,3-thiazolidine-5-carboxylate |
| SMILES | CCOC(=O)C1SC(C)(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)N(CCCBr)C1C=O |
| InChI | InChI=1S/C25H38BrNO4S/c1-9-31-22(30)21-19(15-28)27(12-10-11-26)25(8,32-21)16-13-17(23(2,3)4)20(29)18(14-16)24(5,6)7/h13-15,19,21,29H,9-12H2,1-8H3 |
| InChIKey | CUILDIQSHCHSEN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|