C5H9NO3Si — CID 174398104
3-dimethylsilyl-1,3-oxazolidine-2,4-dione (PubChem CID 174398104) has the molecular formula C5H9NO3Si and a molecular weight of 159.22 g/mol. Its IUPAC name is 3-dimethylsilyl-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-dimethylsilyl-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 174398104 |
| Molecular Formula | C5H9NO3Si |
| Molecular Weight | 159.22 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | 3-dimethylsilyl-1,3-oxazolidine-2,4-dione |
| SMILES | C[SiH](C)N1C(=O)COC1=O |
| InChI | InChI=1S/C5H9NO3Si/c1-10(2)6-4(7)3-9-5(6)8/h10H,3H2,1-2H3 |
| InChIKey | YNUYIJLZIYOLLJ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|