C3H2N4O3 — CID 69315793
3-azido-1,3-oxazolidine-2,4-dione (PubChem CID 69315793) has the molecular formula C3H2N4O3 and a molecular weight of 142.07 g/mol. Its IUPAC name is 3-azido-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-azido-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 69315793 |
| Molecular Formula | C3H2N4O3 |
| Molecular Weight | 142.07 g/mol |
| Exact Mass | 142.01 |
| IUPAC Name | 3-azido-1,3-oxazolidine-2,4-dione |
| SMILES | [N-]=[N+]=NN1C(=O)COC1=O |
| InChI | InChI=1S/C3H2N4O3/c4-5-6-7-2(8)1-10-3(7)9/h1H2 |
| InChIKey | RLMPHSPWSSYZAL-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 95.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.07 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|