C11H24N2O — CID 174403223
(3S)-3,7-diamino-2,6,7-trimethyloctan-4-one (PubChem CID 174403223) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is (3S)-3,7-diamino-2,6,7-trimethyloctan-4-one.
| Compound Name | (3S)-3,7-diamino-2,6,7-trimethyloctan-4-one |
|---|---|
| PubChem CID | 174403223 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | (3S)-3,7-diamino-2,6,7-trimethyloctan-4-one |
| SMILES | CC(C)[C@H](N)C(=O)CC(C)C(C)(C)N |
| InChI | InChI=1S/C11H24N2O/c1-7(2)10(12)9(14)6-8(3)11(4,5)13/h7-8,10H,6,12-13H2,1-5H3/t8?,10-/m0/s1 |
| InChIKey | HOJWFHTVCPBRSE-HTLJXXAVSA-N |
| XLogP | 1.30 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |