C19H26BrNO2 — CID 174427136
2-[4-(1-bromoethyl)-1,3-oxazol-2-yl]-4,6-ditert-butylphenol (PubChem CID 174427136) has the molecular formula C19H26BrNO2 and a molecular weight of 380.33 g/mol. Its IUPAC name is 2-[4-(1-bromoethyl)-1,3-oxazol-2-yl]-4,6-ditert-butylphenol.
| Compound Name | 2-[4-(1-bromoethyl)-1,3-oxazol-2-yl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 174427136 |
| Molecular Formula | C19H26BrNO2 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2-[4-(1-bromoethyl)-1,3-oxazol-2-yl]-4,6-ditert-butylphenol |
| SMILES | CC(Br)c1coc(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)n1 |
| InChI | InChI=1S/C19H26BrNO2/c1-11(20)15-10-23-17(21-15)13-8-12(18(2,3)4)9-14(16(13)22)19(5,6)7/h8-11,22H,1-7H3 |
| InChIKey | OCLKJIZEPWWEHN-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|