C11H27N3 — CID 174431293
1-N,5-N,7-N-trimethyloctane-1,5,7-triamine (PubChem CID 174431293) has the molecular formula C11H27N3 and a molecular weight of 201.36 g/mol. Its IUPAC name is 1-N,5-N,7-N-trimethyloctane-1,5,7-triamine.
| Compound Name | 1-N,5-N,7-N-trimethyloctane-1,5,7-triamine |
|---|---|
| PubChem CID | 174431293 |
| Molecular Formula | C11H27N3 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.22 |
| IUPAC Name | 1-N,5-N,7-N-trimethyloctane-1,5,7-triamine |
| SMILES | CNCCCCC(CC(C)NC)NC |
| InChI | InChI=1S/C11H27N3/c1-10(13-3)9-11(14-4)7-5-6-8-12-2/h10-14H,5-9H2,1-4H3 |
| InChIKey | VUDCOJWTWUDZAV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|