About tripotassium;methoxy(trioxido)silane;propan-2-one
tripotassium;methoxy(trioxido)silane;propan-2-one (PubChem CID 174431992) has the molecular formula C4H9K3O5Si
and a molecular weight of 282.49 g/mol. Its IUPAC name is tripotassium;methoxy(trioxido)silane;propan-2-one.
Molecular Properties
| Compound Name | tripotassium;methoxy(trioxido)silane;propan-2-one |
| PubChem CID | 174431992 |
| Molecular Formula | C4H9K3O5Si |
| Molecular Weight | 282.49 g/mol |
| Exact Mass | 281.91 |
| IUPAC Name | tripotassium;methoxy(trioxido)silane;propan-2-one |
| SMILES | CC(C)=O.CO[Si]([O-])([O-])[O-].[K+].[K+].[K+] |
| InChI | InChI=1S/C3H6O.CH3O4Si.3K/c1-3(2)4;1-5-6(2,3)4;;;/h1-2H3;1H3;;;/q;-3;3*+1 |
| InChIKey | ULXGSYCRGBLDBN-UHFFFAOYSA-N |
| XLogP | -12.24 |
| TPSA | 95.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.49 |
| LogP ≤ 5 | -12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tripotassium;methoxy(trioxido)silane;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tripotassium;methoxy(trioxido)silane;propan-2-one?
The IUPAC name of tripotassium;methoxy(trioxido)silane;propan-2-one (CID 174431992) is tripotassium;methoxy(trioxido)silane;propan-2-one.
What is the SMILES notation for tripotassium;methoxy(trioxido)silane;propan-2-one?
The canonical SMILES for tripotassium;methoxy(trioxido)silane;propan-2-one is CC(C)=O.CO[Si]([O-])([O-])[O-].[K+].[K+].[K+].
What is the InChIKey of tripotassium;methoxy(trioxido)silane;propan-2-one?
The InChIKey is ULXGSYCRGBLDBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.CH3O4Si.3K/c1-3(2)4;1-5-6(2,3)4;;;/h1-2H3;1H3;;;/q;-3;3*+1.
What are the key properties of tripotassium;methoxy(trioxido)silane;propan-2-one?
tripotassium;methoxy(trioxido)silane;propan-2-one has a molecular weight of 282.49 g/mol, XLogP of -12.24, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tripotassium;methoxy(trioxido)silane;propan-2-one is sourced from PubChem (CID 174431992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).