C19H24N4O2 — CID 174443185
2-(aminomethyl)-5-(pyridine-3-carbonyl)cyclohexane-1-carboxamide;pyridine (PubChem CID 174443185) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-(aminomethyl)-5-(pyridine-3-carbonyl)cyclohexane-1-carboxamide;pyridine.
| Compound Name | 2-(aminomethyl)-5-(pyridine-3-carbonyl)cyclohexane-1-carboxamide;pyridine |
|---|---|
| PubChem CID | 174443185 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-(aminomethyl)-5-(pyridine-3-carbonyl)cyclohexane-1-carboxamide;pyridine |
| SMILES | NCC1CCC(C(=O)c2cccnc2)CC1C(N)=O.c1ccncc1 |
| InChI | InChI=1S/C14H19N3O2.C5H5N/c15-7-10-4-3-9(6-12(10)14(16)19)13(18)11-2-1-5-17-8-11;1-2-4-6-5-3-1/h1-2,5,8-10,12H,3-4,6-7,15H2,(H2,16,19);1-5H |
| InChIKey | BDWXSEFKPUOZFY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |