C28H33N3O6 — CID 174456390
4-(4-aminonaphthalen-1-yl)-2-methylbenzene-1,3-dicarboxylic acid;tert-butyl piperazine-1-carboxylate (PubChem CID 174456390) has the molecular formula C28H33N3O6 and a molecular weight of 507.59 g/mol. Its IUPAC name is 4-(4-aminonaphthalen-1-yl)-2-methylbenzene-1,3-dicarboxylic acid;tert-butyl piperazine-1-carboxylate.
| Compound Name | 4-(4-aminonaphthalen-1-yl)-2-methylbenzene-1,3-dicarboxylic acid;tert-butyl piperazine-1-carboxylate |
|---|---|
| PubChem CID | 174456390 |
| Molecular Formula | C28H33N3O6 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 4-(4-aminonaphthalen-1-yl)-2-methylbenzene-1,3-dicarboxylic acid;tert-butyl piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.Cc1c(C(=O)O)ccc(-c2ccc(N)c3ccccc23)c1C(=O)O |
| InChI | InChI=1S/C19H15NO4.C9H18N2O2/c1-10-11(18(21)22)6-7-15(17(10)19(23)24)13-8-9-16(20)14-5-3-2-4-12(13)14;1-9(2,3)13-8(12)11-6-4-10-5-7-11/h2-9H,20H2,1H3,(H,21,22)(H,23,24);10H,4-7H2,1-3H3 |
| InChIKey | GGNNYBOOLVZPKE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|