About [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazol-5-yl] N-benzyl-N-ethylcarbamate
[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazol-5-yl] N-benzyl-N-ethylcarbamate (PubChem CID 174494005) has the molecular formula C18H23N3O5
and a molecular weight of 361.40 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazol-5-yl] N-benzyl-N-ethylcarbamate.
Molecular Properties
| Compound Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazol-5-yl] N-benzyl-N-ethylcarbamate |
| PubChem CID | 174494005 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazol-5-yl] N-benzyl-N-ethylcarbamate |
| SMILES | CCN(Cc1ccccc1)C(=O)Oc1cnc(NC(=O)OC(C)(C)C)o1 |
| InChI | InChI=1S/C18H23N3O5/c1-5-21(12-13-9-7-6-8-10-13)17(23)25-14-11-19-15(24-14)20-16(22)26-18(2,3)4/h6-11H,5,12H2,1-4H3,(H,19,20,22) |
| InChIKey | JTGIARHKOYLUPR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazol-5-yl] N-benzyl-N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazol-5-yl] N-benzyl-N-ethylcarbamate?
The IUPAC name of [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazol-5-yl] N-benzyl-N-ethylcarbamate (CID 174494005) is [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazol-5-yl] N-benzyl-N-ethylcarbamate.
What is the SMILES notation for [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazol-5-yl] N-benzyl-N-ethylcarbamate?
The canonical SMILES for [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazol-5-yl] N-benzyl-N-ethylcarbamate is CCN(Cc1ccccc1)C(=O)Oc1cnc(NC(=O)OC(C)(C)C)o1.
What is the InChIKey of [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazol-5-yl] N-benzyl-N-ethylcarbamate?
The InChIKey is JTGIARHKOYLUPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O5/c1-5-21(12-13-9-7-6-8-10-13)17(23)25-14-11-19-15(24-14)20-16(22)26-18(2,3)4/h6-11H,5,12H2,1-4H3,(H,19,20,22).
What are the key properties of [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazol-5-yl] N-benzyl-N-ethylcarbamate?
[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazol-5-yl] N-benzyl-N-ethylcarbamate has a molecular weight of 361.40 g/mol, XLogP of 4.04, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazol-5-yl] N-benzyl-N-ethylcarbamate is sourced from PubChem (CID 174494005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).