About ethyl-dimethoxy-methylsilane;3-methyloxet-2-one
ethyl-dimethoxy-methylsilane;3-methyloxet-2-one (PubChem CID 174500991) has the molecular formula C9H18O4Si
and a molecular weight of 218.32 g/mol. Its IUPAC name is ethyl-dimethoxy-methylsilane;3-methyloxet-2-one.
Molecular Properties
| Compound Name | ethyl-dimethoxy-methylsilane;3-methyloxet-2-one |
| PubChem CID | 174500991 |
| Molecular Formula | C9H18O4Si |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | ethyl-dimethoxy-methylsilane;3-methyloxet-2-one |
| SMILES | CC1=COC1=O.CC[Si](C)(OC)OC |
| InChI | InChI=1S/C5H14O2Si.C4H4O2/c1-5-8(4,6-2)7-3;1-3-2-6-4(3)5/h5H2,1-4H3;2H,1H3 |
| InChIKey | HNBHXRJGNSPING-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl-dimethoxy-methylsilane;3-methyloxet-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-dimethoxy-methylsilane;3-methyloxet-2-one?
The IUPAC name of ethyl-dimethoxy-methylsilane;3-methyloxet-2-one (CID 174500991) is ethyl-dimethoxy-methylsilane;3-methyloxet-2-one.
What is the SMILES notation for ethyl-dimethoxy-methylsilane;3-methyloxet-2-one?
The canonical SMILES for ethyl-dimethoxy-methylsilane;3-methyloxet-2-one is CC1=COC1=O.CC[Si](C)(OC)OC.
What is the InChIKey of ethyl-dimethoxy-methylsilane;3-methyloxet-2-one?
The InChIKey is HNBHXRJGNSPING-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14O2Si.C4H4O2/c1-5-8(4,6-2)7-3;1-3-2-6-4(3)5/h5H2,1-4H3;2H,1H3.
What are the key properties of ethyl-dimethoxy-methylsilane;3-methyloxet-2-one?
ethyl-dimethoxy-methylsilane;3-methyloxet-2-one has a molecular weight of 218.32 g/mol, XLogP of 1.82, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-dimethoxy-methylsilane;3-methyloxet-2-one is sourced from PubChem (CID 174500991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).