C20H22N4O6 — CID 174502315
[4-(5,6,8,9-tetraoxo-1,4-dihydropyrrolo[3,4-g]quinoxalin-7-yl)piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174502315) has the molecular formula C20H22N4O6 and a molecular weight of 414.42 g/mol. Its IUPAC name is [4-(5,6,8,9-tetraoxo-1,4-dihydropyrrolo[3,4-g]quinoxalin-7-yl)piperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-(5,6,8,9-tetraoxo-1,4-dihydropyrrolo[3,4-g]quinoxalin-7-yl)piperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174502315 |
| Molecular Formula | C20H22N4O6 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | [4-(5,6,8,9-tetraoxo-1,4-dihydropyrrolo[3,4-g]quinoxalin-7-yl)piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCC(n2c(=O)c3c(=O)c4[nH]cc[nH]c4c(=O)c3c2=O)CC1 |
| InChI | InChI=1S/C20H22N4O6/c1-20(2,3)19(29)30-23-8-4-10(5-9-23)24-17(27)11-12(18(24)28)16(26)14-13(15(11)25)21-6-7-22-14/h6-7,10,21-22H,4-5,8-9H2,1-3H3 |
| InChIKey | BJOTVMZJFJFYSK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|