About 2-amino-2-phenylacetamide;pentanenitrile
2-amino-2-phenylacetamide;pentanenitrile (PubChem CID 174503013) has the molecular formula C13H19N3O
and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-amino-2-phenylacetamide;pentanenitrile.
Molecular Properties
| Compound Name | 2-amino-2-phenylacetamide;pentanenitrile |
| PubChem CID | 174503013 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 2-amino-2-phenylacetamide;pentanenitrile |
| SMILES | CCCCC#N.NC(=O)C(N)c1ccccc1 |
| InChI | InChI=1S/C8H10N2O.C5H9N/c9-7(8(10)11)6-4-2-1-3-5-6;1-2-3-4-5-6/h1-5,7H,9H2,(H2,10,11);2-4H2,1H3 |
| InChIKey | ZUMIWOCOQOITKY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-phenylacetamide;pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-phenylacetamide;pentanenitrile?
The IUPAC name of 2-amino-2-phenylacetamide;pentanenitrile (CID 174503013) is 2-amino-2-phenylacetamide;pentanenitrile.
What is the SMILES notation for 2-amino-2-phenylacetamide;pentanenitrile?
The canonical SMILES for 2-amino-2-phenylacetamide;pentanenitrile is CCCCC#N.NC(=O)C(N)c1ccccc1.
What is the InChIKey of 2-amino-2-phenylacetamide;pentanenitrile?
The InChIKey is ZUMIWOCOQOITKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O.C5H9N/c9-7(8(10)11)6-4-2-1-3-5-6;1-2-3-4-5-6/h1-5,7H,9H2,(H2,10,11);2-4H2,1H3.
What are the key properties of 2-amino-2-phenylacetamide;pentanenitrile?
2-amino-2-phenylacetamide;pentanenitrile has a molecular weight of 233.31 g/mol, XLogP of 1.87, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-phenylacetamide;pentanenitrile is sourced from PubChem (CID 174503013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).