C20H19NO4S — CID 174504498
butyl 4-hydroxy-1-oxo-6-phenyl-5-sulfanylidene-2,6-dihydroisoquinoline-3-carboxylate (PubChem CID 174504498) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is butyl 4-hydroxy-1-oxo-6-phenyl-5-sulfanylidene-2,6-dihydroisoquinoline-3-carboxylate.
| Compound Name | butyl 4-hydroxy-1-oxo-6-phenyl-5-sulfanylidene-2,6-dihydroisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 174504498 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | butyl 4-hydroxy-1-oxo-6-phenyl-5-sulfanylidene-2,6-dihydroisoquinoline-3-carboxylate |
| SMILES | CCCCOC(=O)c1[nH]c(=O)c2c(c1O)C(=S)C(c1ccccc1)C=C2 |
| InChI | InChI=1S/C20H19NO4S/c1-2-3-11-25-20(24)16-17(22)15-14(19(23)21-16)10-9-13(18(15)26)12-7-5-4-6-8-12/h4-10,13,22H,2-3,11H2,1H3,(H,21,23) |
| InChIKey | KAZBIJWYMOVUKN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|