C24H23NO7 — CID 67110238
butyl 7-[(2-benzyl-1,3-dioxol-4-yl)oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate (PubChem CID 67110238) has the molecular formula C24H23NO7 and a molecular weight of 437.45 g/mol. Its IUPAC name is butyl 7-[(2-benzyl-1,3-dioxol-4-yl)oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate.
| Compound Name | butyl 7-[(2-benzyl-1,3-dioxol-4-yl)oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 67110238 |
| Molecular Formula | C24H23NO7 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | butyl 7-[(2-benzyl-1,3-dioxol-4-yl)oxy]-4-hydroxy-1-oxo-2H-isoquinoline-3-carboxylate |
| SMILES | CCCCOC(=O)c1[nH]c(=O)c2cc(OC3=COC(Cc4ccccc4)O3)ccc2c1O |
| InChI | InChI=1S/C24H23NO7/c1-2-3-11-29-24(28)21-22(26)17-10-9-16(13-18(17)23(27)25-21)31-20-14-30-19(32-20)12-15-7-5-4-6-8-15/h4-10,13-14,19,26H,2-3,11-12H2,1H3,(H,25,27) |
| InChIKey | MDRCWPKBXIVCCZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|