C18H17NO4S2 — CID 67233453
butyl 7-hydroxy-4-oxo-2-phenylsulfanyl-5H-thieno[3,2-c]pyridine-6-carboxylate (PubChem CID 67233453) has the molecular formula C18H17NO4S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is butyl 7-hydroxy-4-oxo-2-phenylsulfanyl-5H-thieno[3,2-c]pyridine-6-carboxylate.
| Compound Name | butyl 7-hydroxy-4-oxo-2-phenylsulfanyl-5H-thieno[3,2-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 67233453 |
| Molecular Formula | C18H17NO4S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | butyl 7-hydroxy-4-oxo-2-phenylsulfanyl-5H-thieno[3,2-c]pyridine-6-carboxylate |
| SMILES | CCCCOC(=O)c1[nH]c(=O)c2cc(Sc3ccccc3)sc2c1O |
| InChI | InChI=1S/C18H17NO4S2/c1-2-3-9-23-18(22)14-15(20)16-12(17(21)19-14)10-13(25-16)24-11-7-5-4-6-8-11/h4-8,10,20H,2-3,9H2,1H3,(H,19,21) |
| InChIKey | IICPNTSDQKOSQB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|