About N-sulfinylpropanamide
N-sulfinylpropanamide (PubChem CID 174513933) has the molecular formula C3H5NO2S
and a molecular weight of 119.14 g/mol. Its IUPAC name is N-sulfinylpropanamide.
Molecular Properties
| Compound Name | N-sulfinylpropanamide |
| PubChem CID | 174513933 |
| Molecular Formula | C3H5NO2S |
| Molecular Weight | 119.14 g/mol |
| Exact Mass | 119.00 |
| IUPAC Name | N-sulfinylpropanamide |
| SMILES | CCC(=O)N=S=O |
| InChI | InChI=1S/C3H5NO2S/c1-2-3(5)4-7-6/h2H2,1H3 |
| InChIKey | DBWHACNDQVJUKA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.14 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-sulfinylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-sulfinylpropanamide?
The IUPAC name of N-sulfinylpropanamide (CID 174513933) is N-sulfinylpropanamide.
What is the SMILES notation for N-sulfinylpropanamide?
The canonical SMILES for N-sulfinylpropanamide is CCC(=O)N=S=O.
What is the InChIKey of N-sulfinylpropanamide?
The InChIKey is DBWHACNDQVJUKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO2S/c1-2-3(5)4-7-6/h2H2,1H3.
What are the key properties of N-sulfinylpropanamide?
N-sulfinylpropanamide has a molecular weight of 119.14 g/mol, XLogP of 0.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-sulfinylpropanamide is sourced from PubChem (CID 174513933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).