C13H9N — CID 174521661
11-azatetracyclo[8.4.0.02,7.03,12]tetradeca-1(10),2(7),3,5,8,13-hexaene (PubChem CID 174521661) has the molecular formula C13H9N and a molecular weight of 179.22 g/mol. Its IUPAC name is 11-azatetracyclo[8.4.0.02,7.03,12]tetradeca-1(10),2(7),3,5,8,13-hexaene.
| Compound Name | 11-azatetracyclo[8.4.0.02,7.03,12]tetradeca-1(10),2(7),3,5,8,13-hexaene |
|---|---|
| PubChem CID | 174521661 |
| Molecular Formula | C13H9N |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 11-azatetracyclo[8.4.0.02,7.03,12]tetradeca-1(10),2(7),3,5,8,13-hexaene |
| SMILES | C1=CC2Nc3ccc4cccc2c4c31 |
| InChI | InChI=1S/C13H9N/c1-2-8-4-6-11-10-5-7-12(14-11)9(3-1)13(8)10/h1-7,12,14H |
| InChIKey | XMPDUNFMPQYTHK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |