C19H24ClN3S2 — CID 174528643
6-chloro-N-heptyl-N-[2-(1,3-thiazol-4-yl)ethyl]-1,3-benzothiazol-2-amine (PubChem CID 174528643) has the molecular formula C19H24ClN3S2 and a molecular weight of 394.01 g/mol. Its IUPAC name is 6-chloro-N-heptyl-N-[2-(1,3-thiazol-4-yl)ethyl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-N-heptyl-N-[2-(1,3-thiazol-4-yl)ethyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 174528643 |
| Molecular Formula | C19H24ClN3S2 |
| Molecular Weight | 394.01 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 6-chloro-N-heptyl-N-[2-(1,3-thiazol-4-yl)ethyl]-1,3-benzothiazol-2-amine |
| SMILES | CCCCCCCN(CCc1cscn1)c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C19H24ClN3S2/c1-2-3-4-5-6-10-23(11-9-16-13-24-14-21-16)19-22-17-8-7-15(20)12-18(17)25-19/h7-8,12-14H,2-6,9-11H2,1H3 |
| InChIKey | MXLILVUWXWPVIA-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.01 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|