C6H11NO5S2 — CID 174536174
(2R)-2-amino-3-sulfanylpropanoic acid;2-oxo-3-sulfanylpropanoic acid (PubChem CID 174536174) has the molecular formula C6H11NO5S2 and a molecular weight of 241.29 g/mol. Its IUPAC name is (2R)-2-amino-3-sulfanylpropanoic acid;2-oxo-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-sulfanylpropanoic acid;2-oxo-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 174536174 |
| Molecular Formula | C6H11NO5S2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | (2R)-2-amino-3-sulfanylpropanoic acid;2-oxo-3-sulfanylpropanoic acid |
| SMILES | N[C@@H](CS)C(=O)O.O=C(O)C(=O)CS |
| InChI | InChI=1S/C3H7NO2S.C3H4O3S/c2*4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6);7H,1H2,(H,5,6)/t2-;/m0./s1 |
| InChIKey | HDLJXFQXDJTOTK-DKWTVANSSA-N |
| XLogP | -1.10 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|