C25H31N3O4 — CID 174537440
5-[2-[2-[4-[[(1R)-6-ethyl-1-hydroxycyclohexa-2,4-dien-1-yl]amino]phenyl]ethylamino]-1-hydroxyethyl]-2-hydroxybenzamide (PubChem CID 174537440) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 5-[2-[2-[4-[[(1R)-6-ethyl-1-hydroxycyclohexa-2,4-dien-1-yl]amino]phenyl]ethylamino]-1-hydroxyethyl]-2-hydroxybenzamide.
| Compound Name | 5-[2-[2-[4-[[(1R)-6-ethyl-1-hydroxycyclohexa-2,4-dien-1-yl]amino]phenyl]ethylamino]-1-hydroxyethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 174537440 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 5-[2-[2-[4-[[(1R)-6-ethyl-1-hydroxycyclohexa-2,4-dien-1-yl]amino]phenyl]ethylamino]-1-hydroxyethyl]-2-hydroxybenzamide |
| SMILES | CCC1C=CC=C[C@]1(O)Nc1ccc(CCNCC(O)c2ccc(O)c(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C25H31N3O4/c1-2-19-5-3-4-13-25(19,32)28-20-9-6-17(7-10-20)12-14-27-16-23(30)18-8-11-22(29)21(15-18)24(26)31/h3-11,13,15,19,23,27-30,32H,2,12,14,16H2,1H3,(H2,26,31)/t19?,23?,25-/m1/s1 |
| InChIKey | IDHXZSRQEWYUAO-WVSXHZKHSA-N |
| XLogP | 2.61 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|