C28H22ClN2O5S- — CID 174540695
[4-[[1-carboxy-2-[2-(2-phenylethenyl)quinolin-6-yl]ethyl]carbamoyl]-3-chlorophenyl]methanesulfinate (PubChem CID 174540695) has the molecular formula C28H22ClN2O5S- and a molecular weight of 534.01 g/mol. Its IUPAC name is [4-[[1-carboxy-2-[2-(2-phenylethenyl)quinolin-6-yl]ethyl]carbamoyl]-3-chlorophenyl]methanesulfinate.
| Compound Name | [4-[[1-carboxy-2-[2-(2-phenylethenyl)quinolin-6-yl]ethyl]carbamoyl]-3-chlorophenyl]methanesulfinate |
|---|---|
| PubChem CID | 174540695 |
| Molecular Formula | C28H22ClN2O5S- |
| Molecular Weight | 534.01 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | [4-[[1-carboxy-2-[2-(2-phenylethenyl)quinolin-6-yl]ethyl]carbamoyl]-3-chlorophenyl]methanesulfinate |
| SMILES | O=C(NC(Cc1ccc2nc(C=Cc3ccccc3)ccc2c1)C(=O)O)c1ccc(CS(=O)[O-])cc1Cl |
| InChI | InChI=1S/C28H23ClN2O5S/c29-24-15-20(17-37(35)36)7-12-23(24)27(32)31-26(28(33)34)16-19-8-13-25-21(14-19)9-11-22(30-25)10-6-18-4-2-1-3-5-18/h1-15,26H,16-17H2,(H,31,32)(H,33,34)(H,35,36)/p-1 |
| InChIKey | AITRGQZWUGSOBZ-UHFFFAOYSA-M |
| XLogP | 4.86 |
| TPSA | 119.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.01 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|