C14H23O4P — CID 174548595
butoxy-[1-(4-hydroxyphenyl)butan-2-yl]phosphinic acid (PubChem CID 174548595) has the molecular formula C14H23O4P and a molecular weight of 286.31 g/mol. Its IUPAC name is butoxy-[1-(4-hydroxyphenyl)butan-2-yl]phosphinic acid.
| Compound Name | butoxy-[1-(4-hydroxyphenyl)butan-2-yl]phosphinic acid |
|---|---|
| PubChem CID | 174548595 |
| Molecular Formula | C14H23O4P |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | butoxy-[1-(4-hydroxyphenyl)butan-2-yl]phosphinic acid |
| SMILES | CCCCOP(=O)(O)C(CC)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C14H23O4P/c1-3-5-10-18-19(16,17)14(4-2)11-12-6-8-13(15)9-7-12/h6-9,14-15H,3-5,10-11H2,1-2H3,(H,16,17) |
| InChIKey | FRNGWULEJAJMRN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|