C23H22O2 — CID 174554086
3,4-dihydropyran-2-one;1,2,3,4-tetrahydrochrysene (PubChem CID 174554086) has the molecular formula C23H22O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3,4-dihydropyran-2-one;1,2,3,4-tetrahydrochrysene.
| Compound Name | 3,4-dihydropyran-2-one;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174554086 |
| Molecular Formula | C23H22O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 3,4-dihydropyran-2-one;1,2,3,4-tetrahydrochrysene |
| SMILES | O=C1CCC=CO1.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C5H6O2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;6-5-3-1-2-4-7-5/h1,3,5,7,9-12H,2,4,6,8H2;2,4H,1,3H2 |
| InChIKey | CUKCASPNOFUCIV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|