C16H21FN2O4S — CID 174554325
5-[4-(cyclohexylmethyl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde (PubChem CID 174554325) has the molecular formula C16H21FN2O4S and a molecular weight of 356.42 g/mol. Its IUPAC name is 5-[4-(cyclohexylmethyl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde.
| Compound Name | 5-[4-(cyclohexylmethyl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 174554325 |
| Molecular Formula | C16H21FN2O4S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 5-[4-(cyclohexylmethyl)-2-fluoro-6-hydroxyphenyl]-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde |
| SMILES | O=CC1CN(c2c(O)cc(CC3CCCCC3)cc2F)S(=O)(=O)N1 |
| InChI | InChI=1S/C16H21FN2O4S/c17-14-7-12(6-11-4-2-1-3-5-11)8-15(21)16(14)19-9-13(10-20)18-24(19,22)23/h7-8,10-11,13,18,21H,1-6,9H2 |
| InChIKey | BXOVXPYBPNDJGQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|