C19H14O2 — CID 174560523
1-methyl-1,3-dihydrochrysene-2,6-dione (PubChem CID 174560523) has the molecular formula C19H14O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-methyl-1,3-dihydrochrysene-2,6-dione.
| Compound Name | 1-methyl-1,3-dihydrochrysene-2,6-dione |
|---|---|
| PubChem CID | 174560523 |
| Molecular Formula | C19H14O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-methyl-1,3-dihydrochrysene-2,6-dione |
| SMILES | CC1C(=O)CC=c2c1ccc1c2=CC(=O)c2ccccc2-1 |
| InChI | InChI=1S/C19H14O2/c1-11-12-6-7-15-13-4-2-3-5-16(13)19(21)10-17(15)14(12)8-9-18(11)20/h2-8,10-11H,9H2,1H3 |
| InChIKey | YHOSFNZXSLDXAV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |