C9H8O4 — CID 174564249
1,3-dihydroxy-3H-2-benzofuran-1-carbaldehyde (PubChem CID 174564249) has the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. Its IUPAC name is 1,3-dihydroxy-3H-2-benzofuran-1-carbaldehyde.
| Compound Name | 1,3-dihydroxy-3H-2-benzofuran-1-carbaldehyde |
|---|---|
| PubChem CID | 174564249 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 1,3-dihydroxy-3H-2-benzofuran-1-carbaldehyde |
| SMILES | O=CC1(O)OC(O)c2ccccc21 |
| InChI | InChI=1S/C9H8O4/c10-5-9(12)7-4-2-1-3-6(7)8(11)13-9/h1-5,8,11-12H |
| InChIKey | IQHKQCXSRYVFHG-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|