C13H26N4O3 — CID 174571112
1-butyl-3-methyl-2H-imidazole;2,5-diamino-5-oxopentanoic acid (PubChem CID 174571112) has the molecular formula C13H26N4O3 and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-butyl-3-methyl-2H-imidazole;2,5-diamino-5-oxopentanoic acid.
| Compound Name | 1-butyl-3-methyl-2H-imidazole;2,5-diamino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 174571112 |
| Molecular Formula | C13H26N4O3 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 1-butyl-3-methyl-2H-imidazole;2,5-diamino-5-oxopentanoic acid |
| SMILES | CCCCN1C=CN(C)C1.NC(=O)CCC(N)C(=O)O |
| InChI | InChI=1S/C8H16N2.C5H10N2O3/c1-3-4-5-10-7-6-9(2)8-10;6-3(5(9)10)1-2-4(7)8/h6-7H,3-5,8H2,1-2H3;3H,1-2,6H2,(H2,7,8)(H,9,10) |
| InChIKey | VFMQQHRDSRRVNH-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |