C7H11N3O2S — CID 174581860
N-(2-amino-1,3-thiazol-4-yl)-N-ethoxyacetamide (PubChem CID 174581860) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is N-(2-amino-1,3-thiazol-4-yl)-N-ethoxyacetamide.
| Compound Name | N-(2-amino-1,3-thiazol-4-yl)-N-ethoxyacetamide |
|---|---|
| PubChem CID | 174581860 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | N-(2-amino-1,3-thiazol-4-yl)-N-ethoxyacetamide |
| SMILES | CCON(C(C)=O)c1csc(N)n1 |
| InChI | InChI=1S/C7H11N3O2S/c1-3-12-10(5(2)11)6-4-13-7(8)9-6/h4H,3H2,1-2H3,(H2,8,9) |
| InChIKey | UJHLOLQGRRJMQE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|