C14H20N2O5 — CID 174584526
5-(2-methylprop-2-enoyloxy)pentyl 3,5-diaminofuran-2-carboxylate (PubChem CID 174584526) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 5-(2-methylprop-2-enoyloxy)pentyl 3,5-diaminofuran-2-carboxylate.
| Compound Name | 5-(2-methylprop-2-enoyloxy)pentyl 3,5-diaminofuran-2-carboxylate |
|---|---|
| PubChem CID | 174584526 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 5-(2-methylprop-2-enoyloxy)pentyl 3,5-diaminofuran-2-carboxylate |
| SMILES | C=C(C)C(=O)OCCCCCOC(=O)c1oc(N)cc1N |
| InChI | InChI=1S/C14H20N2O5/c1-9(2)13(17)19-6-4-3-5-7-20-14(18)12-10(15)8-11(16)21-12/h8H,1,3-7,15-16H2,2H3 |
| InChIKey | XTKAYCBBIYFQFS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|