C23H17Cl2NO5S3 — CID 174589181
5-[4-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyphenyl]-3H-dithiole-3-sulfonic acid (PubChem CID 174589181) has the molecular formula C23H17Cl2NO5S3 and a molecular weight of 554.50 g/mol. Its IUPAC name is 5-[4-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyphenyl]-3H-dithiole-3-sulfonic acid.
| Compound Name | 5-[4-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyphenyl]-3H-dithiole-3-sulfonic acid |
|---|---|
| PubChem CID | 174589181 |
| Molecular Formula | C23H17Cl2NO5S3 |
| Molecular Weight | 554.50 g/mol |
| Exact Mass | 552.96 |
| IUPAC Name | 5-[4-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxyphenyl]-3H-dithiole-3-sulfonic acid |
| SMILES | O=C(Cc1ccccc1Nc1c(Cl)cccc1Cl)Oc1ccc(C2=CC(S(=O)(=O)O)SS2)cc1 |
| InChI | InChI=1S/C23H17Cl2NO5S3/c24-17-5-3-6-18(25)23(17)26-19-7-2-1-4-15(19)12-21(27)31-16-10-8-14(9-11-16)20-13-22(33-32-20)34(28,29)30/h1-11,13,22,26H,12H2,(H,28,29,30) |
| InChIKey | WDGHSOUXLFTTLE-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.50 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|