C19H15N5 — CID 174595780
3-(2-anilino-4-pyridinyl)-2,6-naphthyridin-1-amine (PubChem CID 174595780) has the molecular formula C19H15N5 and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-(2-anilino-4-pyridinyl)-2,6-naphthyridin-1-amine.
| Compound Name | 3-(2-anilino-4-pyridinyl)-2,6-naphthyridin-1-amine |
|---|---|
| PubChem CID | 174595780 |
| Molecular Formula | C19H15N5 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3-(2-anilino-4-pyridinyl)-2,6-naphthyridin-1-amine |
| SMILES | Nc1nc(-c2ccnc(Nc3ccccc3)c2)cc2cnccc12 |
| InChI | InChI=1S/C19H15N5/c20-19-16-7-8-21-12-14(16)10-17(24-19)13-6-9-22-18(11-13)23-15-4-2-1-3-5-15/h1-12H,(H2,20,24)(H,22,23) |
| InChIKey | ZTBIWGYJDKCSEI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |