C14H17N3O2S — CID 174599147
4-butyl-N-[nitro(phenyl)methyl]-1,3-thiazol-2-amine (PubChem CID 174599147) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 4-butyl-N-[nitro(phenyl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-butyl-N-[nitro(phenyl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 174599147 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 4-butyl-N-[nitro(phenyl)methyl]-1,3-thiazol-2-amine |
| SMILES | CCCCc1csc(NC(c2ccccc2)[N+](=O)[O-])n1 |
| InChI | InChI=1S/C14H17N3O2S/c1-2-3-9-12-10-20-14(15-12)16-13(17(18)19)11-7-5-4-6-8-11/h4-8,10,13H,2-3,9H2,1H3,(H,15,16) |
| InChIKey | OQDBSBHUVSWYEK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|