C7H11NO6 — CID 174599917
(2R,3S,4R,5R,6R)-3,4,5,6-tetrahydroxy-2-(hydroxymethyl)oxane-3-carbonitrile (PubChem CID 174599917) has the molecular formula C7H11NO6 and a molecular weight of 205.17 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-3,4,5,6-tetrahydroxy-2-(hydroxymethyl)oxane-3-carbonitrile.
| Compound Name | (2R,3S,4R,5R,6R)-3,4,5,6-tetrahydroxy-2-(hydroxymethyl)oxane-3-carbonitrile |
|---|---|
| PubChem CID | 174599917 |
| Molecular Formula | C7H11NO6 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | (2R,3S,4R,5R,6R)-3,4,5,6-tetrahydroxy-2-(hydroxymethyl)oxane-3-carbonitrile |
| SMILES | N#C[C@]1(O)[C@H](O)[C@@H](O)[C@H](O)O[C@@H]1CO |
| InChI | InChI=1S/C7H11NO6/c8-2-7(13)3(1-9)14-6(12)4(10)5(7)11/h3-6,9-13H,1H2/t3-,4-,5-,6-,7-/m1/s1 |
| InChIKey | KXGYSNOELOHPFI-NYMZXIIRSA-N |
| XLogP | -3.33 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|