C7H12N2O3 — CID 174600635
bis(1,3-oxazolidin-5-yl)methanone (PubChem CID 174600635) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is bis(1,3-oxazolidin-5-yl)methanone.
| Compound Name | bis(1,3-oxazolidin-5-yl)methanone |
|---|---|
| PubChem CID | 174600635 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | bis(1,3-oxazolidin-5-yl)methanone |
| SMILES | O=C(C1CNCO1)C1CNCO1 |
| InChI | InChI=1S/C7H12N2O3/c10-7(5-1-8-3-11-5)6-2-9-4-12-6/h5-6,8-9H,1-4H2 |
| InChIKey | XOJUENSHBYKHEQ-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |