C6H7NO4 — CID 174956648
3-(1,3-oxazolidin-5-yl)-2,3-dioxopropanal (PubChem CID 174956648) has the molecular formula C6H7NO4 and a molecular weight of 157.12 g/mol. Its IUPAC name is 3-(1,3-oxazolidin-5-yl)-2,3-dioxopropanal.
| Compound Name | 3-(1,3-oxazolidin-5-yl)-2,3-dioxopropanal |
|---|---|
| PubChem CID | 174956648 |
| Molecular Formula | C6H7NO4 |
| Molecular Weight | 157.12 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | 3-(1,3-oxazolidin-5-yl)-2,3-dioxopropanal |
| SMILES | O=CC(=O)C(=O)C1CNCO1 |
| InChI | InChI=1S/C6H7NO4/c8-2-4(9)6(10)5-1-7-3-11-5/h2,5,7H,1,3H2 |
| InChIKey | HIMZVIIAMFWVFY-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.12 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|