C6H10N2O3 — CID 68541946
N-methyl-2-(1,3-oxazolidin-5-yl)-2-oxoacetamide (PubChem CID 68541946) has the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. Its IUPAC name is N-methyl-2-(1,3-oxazolidin-5-yl)-2-oxoacetamide.
| Compound Name | N-methyl-2-(1,3-oxazolidin-5-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 68541946 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | N-methyl-2-(1,3-oxazolidin-5-yl)-2-oxoacetamide |
| SMILES | CNC(=O)C(=O)C1CNCO1 |
| InChI | InChI=1S/C6H10N2O3/c1-7-6(10)5(9)4-2-8-3-11-4/h4,8H,2-3H2,1H3,(H,7,10) |
| InChIKey | VDERHCXSWDXKSH-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|