C25H31N5O5 — CID 174605726
4-(1,3-benzodioxol-5-yl)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-2-(3-iminohexyl)-3H-1,2,4-triazole-5-carboxamide (PubChem CID 174605726) has the molecular formula C25H31N5O5 and a molecular weight of 481.55 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-2-(3-iminohexyl)-3H-1,2,4-triazole-5-carboxamide.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-2-(3-iminohexyl)-3H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 174605726 |
| Molecular Formula | C25H31N5O5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-3-(2,4-dihydroxy-5-propan-2-ylphenyl)-2-(3-iminohexyl)-3H-1,2,4-triazole-5-carboxamide |
| SMILES | [H]/N=C(\CCC)CCN1N=C(C(N)=O)N(c2ccc3c(c2)OCO3)C1c1cc(C(C)C)c(O)cc1O |
| InChI | InChI=1S/C25H31N5O5/c1-4-5-15(26)8-9-29-25(18-11-17(14(2)3)19(31)12-20(18)32)30(24(28-29)23(27)33)16-6-7-21-22(10-16)35-13-34-21/h6-7,10-12,14,25-26,31-32H,4-5,8-9,13H2,1-3H3,(H2,27,33)/b26-15+ |
| InChIKey | JPZWZOLFGPEBAM-CVKSISIWSA-N |
| XLogP | 3.78 |
| TPSA | 144.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|