C7H13NO3 — CID 174630978
2-[2-(hydroxymethyl)-1,3-oxazolidin-4-yl]propanal (PubChem CID 174630978) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is 2-[2-(hydroxymethyl)-1,3-oxazolidin-4-yl]propanal.
| Compound Name | 2-[2-(hydroxymethyl)-1,3-oxazolidin-4-yl]propanal |
|---|---|
| PubChem CID | 174630978 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 2-[2-(hydroxymethyl)-1,3-oxazolidin-4-yl]propanal |
| SMILES | CC(C=O)C1COC(CO)N1 |
| InChI | InChI=1S/C7H13NO3/c1-5(2-9)6-4-11-7(3-10)8-6/h2,5-8,10H,3-4H2,1H3 |
| InChIKey | ZOVBSXANVZYOOK-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|