C5H9NO3 — CID 175512028
(4R)-4-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde (PubChem CID 175512028) has the molecular formula C5H9NO3 and a molecular weight of 131.13 g/mol. Its IUPAC name is (4R)-4-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde.
| Compound Name | (4R)-4-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 175512028 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | (4R)-4-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde |
| SMILES | O=CC1N[C@H](CO)CO1 |
| InChI | InChI=1S/C5H9NO3/c7-1-4-3-9-5(2-8)6-4/h2,4-7H,1,3H2/t4-,5?/m1/s1 |
| InChIKey | LGQHATAITICWFL-CNZKWPKMSA-N |
| XLogP | -1.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|