C9H16O7 — CID 22507450
bis(oxirane-2-carbaldehyde);propane-1,2,3-triol (PubChem CID 22507450) has the molecular formula C9H16O7 and a molecular weight of 236.22 g/mol. Its IUPAC name is bis(oxirane-2-carbaldehyde);propane-1,2,3-triol.
| Compound Name | bis(oxirane-2-carbaldehyde);propane-1,2,3-triol |
|---|---|
| PubChem CID | 22507450 |
| Molecular Formula | C9H16O7 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | bis(oxirane-2-carbaldehyde);propane-1,2,3-triol |
| SMILES | O=CC1CO1.O=CC1CO1.OCC(O)CO |
| InChI | InChI=1S/C3H8O3.2C3H4O2/c4-1-3(6)2-5;2*4-1-3-2-5-3/h3-6H,1-2H2;2*1,3H,2H2 |
| InChIKey | ISDOQLOSSOKAFE-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 119.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|