C6H12O5 — CID 87531271
oxirane-2-carbaldehyde;propane-1,2,3-triol (PubChem CID 87531271) has the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. Its IUPAC name is oxirane-2-carbaldehyde;propane-1,2,3-triol.
| Compound Name | oxirane-2-carbaldehyde;propane-1,2,3-triol |
|---|---|
| PubChem CID | 87531271 |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | oxirane-2-carbaldehyde;propane-1,2,3-triol |
| SMILES | O=CC1CO1.OCC(O)CO |
| InChI | InChI=1S/C3H8O3.C3H4O2/c4-1-3(6)2-5;4-1-3-2-5-3/h3-6H,1-2H2;1,3H,2H2 |
| InChIKey | COQGUAXYRJRZGR-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|