C14H25NO2 — CID 174640361
2,6-dimethylaniline;hexane-1,1-diol (PubChem CID 174640361) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 2,6-dimethylaniline;hexane-1,1-diol.
| Compound Name | 2,6-dimethylaniline;hexane-1,1-diol |
|---|---|
| PubChem CID | 174640361 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 2,6-dimethylaniline;hexane-1,1-diol |
| SMILES | CCCCCC(O)O.Cc1cccc(C)c1N |
| InChI | InChI=1S/C8H11N.C6H14O2/c1-6-4-3-5-7(2)8(6)9;1-2-3-4-5-6(7)8/h3-5H,9H2,1-2H3;6-8H,2-5H2,1H3 |
| InChIKey | PEXYAPNNDMACLI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|