About 4-aminoselanylphenol
4-aminoselanylphenol (PubChem CID 174642710) has the molecular formula C6H7NOSe
and a molecular weight of 188.09 g/mol. Its IUPAC name is 4-aminoselanylphenol.
Molecular Properties
| Compound Name | 4-aminoselanylphenol |
| PubChem CID | 174642710 |
| Molecular Formula | C6H7NOSe |
| Molecular Weight | 188.09 g/mol |
| Exact Mass | 188.97 |
| IUPAC Name | 4-aminoselanylphenol |
| SMILES | N[Se]c1ccc(O)cc1 |
| InChI | InChI=1S/C6H7NOSe/c7-9-6-3-1-5(8)2-4-6/h1-4,8H,7H2 |
| InChIKey | QAILIZWBUPLDCP-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.09 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-aminoselanylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminoselanylphenol?
The IUPAC name of 4-aminoselanylphenol (CID 174642710) is 4-aminoselanylphenol.
What is the SMILES notation for 4-aminoselanylphenol?
The canonical SMILES for 4-aminoselanylphenol is N[Se]c1ccc(O)cc1.
What is the InChIKey of 4-aminoselanylphenol?
The InChIKey is QAILIZWBUPLDCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NOSe/c7-9-6-3-1-5(8)2-4-6/h1-4,8H,7H2.
What are the key properties of 4-aminoselanylphenol?
4-aminoselanylphenol has a molecular weight of 188.09 g/mol, XLogP of -0.40, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminoselanylphenol is sourced from PubChem (CID 174642710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).