About 4-methoxyselanylphenol
4-methoxyselanylphenol (PubChem CID 20836022) has the molecular formula C7H8O2Se
and a molecular weight of 203.10 g/mol. Its IUPAC name is 4-methoxyselanylphenol.
Molecular Properties
| Compound Name | 4-methoxyselanylphenol |
| PubChem CID | 20836022 |
| Molecular Formula | C7H8O2Se |
| Molecular Weight | 203.10 g/mol |
| Exact Mass | 203.97 |
| IUPAC Name | 4-methoxyselanylphenol |
| SMILES | CO[Se]c1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O2Se/c1-9-10-7-4-2-6(8)3-5-7/h2-5,8H,1H3 |
| InChIKey | MPWYYKDZXSGDIL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.10 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxyselanylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxyselanylphenol?
The IUPAC name of 4-methoxyselanylphenol (CID 20836022) is 4-methoxyselanylphenol.
What is the SMILES notation for 4-methoxyselanylphenol?
The canonical SMILES for 4-methoxyselanylphenol is CO[Se]c1ccc(O)cc1.
What is the InChIKey of 4-methoxyselanylphenol?
The InChIKey is MPWYYKDZXSGDIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2Se/c1-9-10-7-4-2-6(8)3-5-7/h2-5,8H,1H3.
What are the key properties of 4-methoxyselanylphenol?
4-methoxyselanylphenol has a molecular weight of 203.10 g/mol, XLogP of 0.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxyselanylphenol is sourced from PubChem (CID 20836022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).