C19H32NO4S+ — CID 174665221
[2-[(3S)-3,7-dimethyloct-6-enoxy]sulfonyl-5-hydroxyphenyl]-trimethylazanium (PubChem CID 174665221) has the molecular formula C19H32NO4S+ and a molecular weight of 370.54 g/mol. Its IUPAC name is [2-[(3S)-3,7-dimethyloct-6-enoxy]sulfonyl-5-hydroxyphenyl]-trimethylazanium.
| Compound Name | [2-[(3S)-3,7-dimethyloct-6-enoxy]sulfonyl-5-hydroxyphenyl]-trimethylazanium |
|---|---|
| PubChem CID | 174665221 |
| Molecular Formula | C19H32NO4S+ |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [2-[(3S)-3,7-dimethyloct-6-enoxy]sulfonyl-5-hydroxyphenyl]-trimethylazanium |
| SMILES | CC(C)=CCC[C@H](C)CCOS(=O)(=O)c1ccc(O)cc1[N+](C)(C)C |
| InChI | InChI=1S/C19H31NO4S/c1-15(2)8-7-9-16(3)12-13-24-25(22,23)19-11-10-17(21)14-18(19)20(4,5)6/h8,10-11,14,16H,7,9,12-13H2,1-6H3/p+1/t16-/m0/s1 |
| InChIKey | ABFZUAVVVZWICW-INIZCTEOSA-O |
| XLogP | 4.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|