C20H24O9 — CID 174672609
5-butoxycarbonyl-1-methylcyclohexa-2,4-diene-1-carboxylic acid;3,4,5-trihydroxybenzoic acid (PubChem CID 174672609) has the molecular formula C20H24O9 and a molecular weight of 408.40 g/mol. Its IUPAC name is 5-butoxycarbonyl-1-methylcyclohexa-2,4-diene-1-carboxylic acid;3,4,5-trihydroxybenzoic acid.
| Compound Name | 5-butoxycarbonyl-1-methylcyclohexa-2,4-diene-1-carboxylic acid;3,4,5-trihydroxybenzoic acid |
|---|---|
| PubChem CID | 174672609 |
| Molecular Formula | C20H24O9 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 5-butoxycarbonyl-1-methylcyclohexa-2,4-diene-1-carboxylic acid;3,4,5-trihydroxybenzoic acid |
| SMILES | CCCCOC(=O)C1=CC=CC(C)(C(=O)O)C1.O=C(O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C13H18O4.C7H6O5/c1-3-4-8-17-11(14)10-6-5-7-13(2,9-10)12(15)16;8-4-1-3(7(11)12)2-5(9)6(4)10/h5-7H,3-4,8-9H2,1-2H3,(H,15,16);1-2,8-10H,(H,11,12) |
| InChIKey | IXCZWLFXEMGRLK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|